What is the 2-Chloro-3,5-dibromo-4-methylpyridine?

2-Chloro-3,5-dibromo-4-methylpyridine is , while it's Molecular Formula is C 6 H 4 Br 2 ClN. Used in Pharmaceutical Industry: 2-Chloro-3,5-dibromo-4-methylpyridine is used as an intermediate in the synthesis of various pharmaceutical compounds for its unique reactivity and functional groups. Its presence in the molecular structure can influence the properties and efficacy of the final drug products. Used in Organic Synthesis: In the field of organic synthesis, 2-Chloro-3,5-dibromo-4-methylpyridine serves as a key building block for the creation of complex organic molecules. Its distinct substituent groups allow for versatile chemical reactions, facilitating the development of novel compounds with potential applications in various industries. Safety Precautions: As with many organic chemicals, it is crucial to follow safety precautions while handling 2-Chloro-3,5-dibromo-4-methylpyridine to minimize potential health hazards. Proper protective equipment, controlled environments, and adherence to safety guidelines are essential to ensure the safe use of 2-Chloro-3,5-dibromo-4-methylpyridine in research and industrial applications.

What is the CAS number for 2-Chloro-3,5-dibromo-4-methylpyridine?

The CAS number of 2-Chloro-3,5-dibromo-4-methylpyridine is 1000017-92-4.

What is the 2-Chloro-3,5-dibromo-4-methylpyridine?

2-Chloro-3,5-dibromo-4-methylpyridine is , while it's Molecular Formula is C 6 H 4 Br 2 ClN. Used in Pharmaceutical Industry: 2-Chloro-3,5-dibromo-4-methylpyridine is used as an intermediate in the synthesis of various pharmaceutical compounds for its unique reactivity and functional groups. Its presence in the molecular structure can influence the properties and efficacy of the final drug products. Used in Organic Synthesis: In the field of organic synthesis, 2-Chloro-3,5-dibromo-4-methylpyridine serves as a key building block for the creation of complex organic molecules. Its distinct substituent groups allow for versatile chemical reactions, facilitating the development of novel compounds with potential applications in various industries. Safety Precautions: As with many organic chemicals, it is crucial to follow safety precautions while handling 2-Chloro-3,5-dibromo-4-methylpyridine to minimize potential health hazards. Proper protective equipment, controlled environments, and adherence to safety guidelines are essential to ensure the safe use of 2-Chloro-3,5-dibromo-4-methylpyridine in research and industrial applications.

What is the CAS number for 2-Chloro-3,5-dibromo-4-methylpyridine?

The CAS number of 2-Chloro-3,5-dibromo-4-methylpyridine is 1000017-92-4.

Quality Factory Supply 99% Pure 2-Chloro-3,5-dibromo-4-methylpyridine 1000017-92-4 with Efficient Delivery

Q: What is 2-Chloro-3,5-dibromo-4-methylpyridine (1000017-92-4) used for?

2-Chloro-3,5-dibromo-4-methylpyridine is a functionalized pyridine compound characterized by its unique chemical reactivity due to the presence of a chlorine atom, a methyl group, and two bromine atoms on its aromatic pyridine ring. This yellowish organic chemical is often utilized in pharmaceuticals and organic synthesis, with a molecular formula of C6H4Br2ClN.InChI:InChI=1/C6H4Br2ClN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3

2-Chloro-3,5-dibromo-4-methylpyridine

CAS No.: 1000017-92-4
Purity: 99%

Quality Factory Supply 99% Pure 2-Chloro-3,5-dibromo-4-methylpyridine 1000017-92-4 with Efficient Delivery

Molecular Formula: C₆H₄Br₂ClN
Molecular Weight: 285.365
Boiling Point: 285.1 °C at 760 mmHg
PKA: -2.21±0.10(Predicted)
Flash Point: 126.2 °C
PSA： 12.89000
Density: 1.992 g/cm³
LogP: 3.56840

2-Chloro-3,5-dibromo-4-methylpyridine(Cas 1000017-92-4) Usage

General Description

2-Chloro-3,5-dibromo-4-methylpyridine is a chemical compound often used in pharmaceuticals and organic synthesis due to its properties as a functionalized pyridine. This aromatic organic compound has three distinct substituent groups on its pyridine ring: a chlorine atom, a methyl group and two bromine atoms, which give it unique chemical reactivity. Its molecular formula is C6H4Br2ClN and it's characterized by its yellowish appearance. As with many organic chemicals, safety precautions must be followed while handling this compound to avoid any potential health hazards.

InChI:InChI=1/C6H4Br2ClN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3